A1568012
4'-(Benzyloxy)benzylidene-4-fluoroaniline , >98.0%(GC) , 70627-52-0
CAS NO.：70627-52-0
Empirical Formula: C20H16FNO
Molecular Weight: 305.35
MDL number: MFCD00017951
EINECS: 615-134-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB55.20 | In Stock |
|
| 5G | RMB140.00 | In Stock |
|
| 10g | RMB234.40 | In Stock |
|
| 25G | RMB328.00 | In Stock |
|
| 100g | RMB798.40 | In Stock |
|
| 500g | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-138 ºC |
| Boiling point: | 455.2±35.0 °C(Predicted) |
| Density | 1.07 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetonitrile (Slightly), Chlorofrom (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 3.71±0.50(Predicted) |
| color | Very Dark Orange |
| InChI | InChI=1S/C20H16FNO/c21-18-8-10-19(11-9-18)22-14-16-6-12-20(13-7-16)23-15-17-4-2-1-3-5-17/h1-14H,15H2 |
| InChIKey | IWNBEFDVKWCBFY-UHFFFAOYSA-N |
| SMILES | C1(N=CC2=CC=C(OCC3=CC=CC=C3)C=C2)=CC=C(F)C=C1 |
| CAS DataBase Reference | 70627-52-0 |
Description and Uses
4-Benzyloxybenzylidene 4-Fluoroaniline is an intermediate in the synthesis of Linezolid (L466500).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2925.29.9000 |
