A0814412
3-Acetamidophenylboronic acid pinacol ester , ≥97% , 480424-93-9
Synonym(s):
3′-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)acetanilide
| Pack Size | Price | Stock | Quantity |
| 1G | RMB228.80 | In Stock |
|
| 5G | RMB500.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-190 °C(lit.) |
| Boiling point: | 430.3±28.0 °C(Predicted) |
| Density | 1.07±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 15.23±0.70(Predicted) |
| color | White to Almost white |
| λmax | 286nm(EtOH)(lit.) |
| InChI | 1S/C14H20BNO3/c1-10(17)16-12-8-6-7-11(9-12)15-18-13(2,3)14(4,5)19-15/h6-9H,1-5H3,(H,16,17) |
| InChIKey | CZFSGYCLOCCASM-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc(c1)B2OC(C)(C)C(C)(C)O2 |
| CAS DataBase Reference | 480424-93-9(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







