PRODUCT Properties
| Melting point: | 299℃ |
| alpha | D -280° (c = 0.1 in DMF) |
| Boiling point: | 386.03°C (rough estimate) |
| Density | 1.3358 (rough estimate) |
| refractive index | 1.4790 (estimate) |
| Flash point: | 11 °C |
| storage temp. | 2-8°C |
| solubility | Acetonitrile:Methanol (1:1): 1 mg/ml |
| pka | 10.76±0.20(Predicted) |
| form | White to yellow powder. |
| color | White to off-white |
| BRN | 1630643 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | InChI=1S/C17H12O7/c1-21-9-6-10-13(17(20)4-5-22-16(17)23-10)14-12(9)7-2-3-8(18)11(7)15(19)24-14/h4-6,16,20H,2-3H2,1H3/t16-,17-/m1/s1 |
| InChIKey | MJBWDEQAUQTVKK-IAGOWNOFSA-N |
| SMILES | C1(=O)OC2C3[C@]4(O)C=CO[C@]4([H])OC=3C=C(OC)C=2C2CCC(=O)C1=2 |
Description and Uses
An Aspergillus flavus metabolite. Aflatoxin M1 in milk as a secondary metabolite of the Aflatoxin B1 formed in moldy forages. It is cancerogenic, hepatotoxic, and immunosuppressive in animals and man.
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H340-H350 |
| Precautionary statements | P202-P260-P264-P280-P302+P352+P310-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T+,T,F,Xn |
| Risk Statements | 26/27/28-40-39/23/24/25-23/25-23/24/25-11-36-20/21/22-45 |
| Safety Statements | 53-22-36/37/39-45-24-16-7-36-26-36/37-28 |
| RIDADR | UN 3462 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | GY1880000 |
| F | 10-23 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29322090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| Toxicity | LD50 orally in day old Pekin ducklings: 16.6 mg/duckling (Holzapfel, Steyn) |
