A0818150
2-Azido-2-deoxy-D-glucose , ≥98% , 56883-39-7
CAS NO.:56883-39-7
Empirical Formula: C6H11N3O5
Molecular Weight: 205.169
MDL number: MFCD09750677
EINECS: 635-821-9
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB159.20 | In Stock |
|
| 100mg | RMB559.20 | In Stock |
|
| 250mg | RMB1166.40 | In Stock |
|
| 1g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >149oC (dec.) |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Water (Slightly) |
| form | Solid |
| color | White |
| optical activity | [α]/D 22.5±1.0°, c = 1 in H2O |
| BRN | 2216646 |
| InChI | InChI=1/C6H11N3O5/c7-9-8-3-5(12)4(11)2(1-10)14-6(3)13/h2-6,10-13H,1H2/t2-,3-,4-,5-,6?/s3 |
| InChIKey | URARQBMUQIRZQO-QZGCUHCDSA-N |
| SMILES | [C@H]1(N=[N+]=[N-])C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |&1:0,7,10,12,r| |
Description and Uses
2-Azido-2-deoxy-D-glucose is a glucose derivative that have been used to study the substrate specificity of galactokinase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 29329990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |





![1,3,4,6-Tetra-O-acetyl-2-deoxy-2-[(2-azidoacetyl)amino]-β-D-glucopyranose](https://img.chemicalbook.com/CAS/20211123/GIF/857677-98-6.gif)