PRODUCT Properties
| Melting point: | 100-104 °C |
| Boiling point: | 450.9±45.0 °C(Predicted) |
| Density | 1.5259 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -1.12±0.10(Predicted) |
| form | Solid |
| color | Yellow |
| Water Solubility | insoluble |
| InChI | InChI=1S/C13H9BrFNO/c14-8-5-6-12(16)10(7-8)13(17)9-3-1-2-4-11(9)15/h1-7H,16H2 |
| InChIKey | XCOKDXNGCQXFCV-UHFFFAOYSA-N |
| SMILES | C(C1=CC(Br)=CC=C1N)(C1=CC=CC=C1F)=O |
| CAS DataBase Reference | 1479-58-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Amino-5-bromo-2'-fluorobenzophenone(1479-58-9) |
Description and Uses
Intermeidate in the preparation of many GABA modulators
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Safety Statements | 24/25 |
| HS Code | 29223990 |
