A0826612
9-Acridinecarboxylic Acid Hydrate , >97.0%(HPLC) , 332927-03-4
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB47.20 | In Stock |
|
| 1G | RMB106.40 | In Stock |
|
| 5G | RMB392.00 | In Stock |
|
| 25g | RMB1623.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 290 °C (dec.)(lit.) |
| storage temp. | Refrigerator |
| solubility | Aqueous Base (Slightly), DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| form | Crystalline Powder |
| color | Bright yellow to yellow-green |
| BRN | 171327 |
| InChI | 1S/C14H9NO2.H2O/c16-14(17)13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;/h1-8H,(H,16,17);1H2 |
| InChIKey | ZQAZWHSZYVXGMP-UHFFFAOYSA-N |
| SMILES | [H]O[H].OC(=O)c1c2ccccc2nc3ccccc13 |
| CAS DataBase Reference | 332927-03-4(CAS DataBase Reference) |
Description and Uses
9-Acridinecarboxylic acid hydrate has been used to synthesize a DNA intercalator in order to capture double-stranded DNAs (dsDNAs) duplex from the solution.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2933.99.7000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





