A0827512
2-Acetyl-5-chlorothiophene , >99.0%(GC) , 6310-09-4
Synonym(s):
5-Chloro-2-thienyl methyl ketone
CAS NO.:6310-09-4
Empirical Formula: C6H5ClOS
Molecular Weight: 160.62
MDL number: MFCD00005444
EINECS: 228-630-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB200.80 | In Stock |
|
| 50G | RMB799.20 | In Stock |
|
| 250G | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46-49 °C (lit.) |
| Boiling point: | 117-118 °C/17 mmHg (lit.) |
| Density | 1.3240 (estimate) |
| Flash point: | 227 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystals or Crystalline Powder |
| color | White to light yellow |
| Sensitive | Light Sensitive |
| BRN | 113936 |
| InChI | InChI=1S/C6H5ClOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
| InChIKey | HTZGPEHWQCRXGZ-UHFFFAOYSA-N |
| SMILES | C(=O)(C1SC(Cl)=CC=1)C |
| CAS DataBase Reference | 6310-09-4(CAS DataBase Reference) |
Description and Uses
2-Acetyl-5-chlorothiophene serves as a precursor for synthesizing thiophene chalcones via Claisen-Schmidt condensation with heterocyclic or aromatic aldehydes, such as benzaldehyde, 4-chlorobenzaldehyde, and 2,4-dimethoxybenzaldehyde, in the presence of sodium hydroxide[6-8].
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H319 |
| Precautionary statements | P264-P270-P280-P301+P310-P305+P351+P338-P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 20/21/22 |
| Safety Statements | 24/25-36/37 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | OB1745000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 |
| REACH Registrations | Active |






