A0828312
5-Acetoxymethylfurfural , >98.0%(GC) , 10551-58-3
CAS NO.:10551-58-3
Empirical Formula: C8H8O4
Molecular Weight: 168.15
MDL number: MFCD00003233
EINECS: 234-137-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB143.20 | In Stock |
|
| 5G | RMB503.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-55 °C (lit.) |
| Boiling point: | 122 °C / 2mmHg |
| Density | 1.230 |
| refractive index | 1.4611 (estimate) |
| Flash point: | 226 °F |
| storage temp. | Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystals |
| color | Brown |
| Sensitive | Air Sensitive |
| InChI | 1S/C8H8O4/c1-6(10)11-5-8-3-2-7(4-9)12-8/h2-4H,5H2,1H3 |
| InChIKey | QAVITTVTXPZTSE-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(COC(C)=O)o1 |
| CAS DataBase Reference | 10551-58-3(CAS DataBase Reference) |
Description and Uses
5-Acetoxymethyl-2-furaldehyde can be used for reduction of off-taste of vinegar.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335-H319 |
| Precautionary statements | P305+P351+P338-P261-P280a-P304+P340-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29321900 |
| Storage Class | 11 - Combustible Solids |





