A0828812
Argatroban Monohydrate , >99.0%(HPLC) , 141396-28-3
Synonym(s):
(2R,4R)-1-[(2S)-5-[(Aminoiminomethyl)amino]-1-oxo-2-[[(1,2,3,4-tetrahydro-3-methyl-8-quinolinyl)sulfonyl]amino]pentyl]-4-methyl-2-piperidinecarboxylic Acid;Argipidine;MQPA
CAS NO.:141396-28-3
Empirical Formula: C23H38N6O6S
Molecular Weight: 526.65
MDL number: MFCD00895735
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB142.40 | In Stock |
|
| 5mg | RMB288.80 | In Stock |
|
| 100mg | RMB456.80 | In Stock |
|
| 250mg | RMB600.00 | In Stock |
|
| 25MG | RMB852.80 | In Stock |
|
| 1g | RMB1824.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 176-180° |
| alpha | D27 +76.1° (c = 1 in 0.2N HCl) |
| storage temp. | 2-8°C |
| solubility | DMSO: ≥20mg/mL |
| form | Solid |
| color | white to off-white |
| Merck | 14,779 |
| InChIKey | AIEZTKLTLCMZIA-WOXJCXRUNA-N |
| SMILES | C12NCC(C)CC=1C=CC=C2S(=O)(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CC[C@@H](C)C[C@@H]1C(=O)O.O |&1:15,28,31,r| |
| CAS DataBase Reference | 141396-28-3(CAS DataBase Reference) |
Description and Uses
Anticoagulant.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H223+H229 |
| WGK Germany | 3 |
| RTECS | TM6126610 |
| HS Code | 29350090 |
| Toxicity | mouse,LD50,intraperitoneal,475mg/kg (475mg/kg),LUNGS, THORAX, OR RESPIRATION: DYSPNEABLOOD: NORMOCYTIC ANEMIABEHAVIORAL: SOMNOLENCE (GENERAL DEPRESSED ACTIVITY),Yakuri to Chiryo. Pharmacology and Therapeutics. Vol. 14(Suppl, |




