A0834150
Sodiumperfluorooctanoate , 97% , 335-95-5
CAS NO.：335-95-5
Empirical Formula: C8F15NaO2
Molecular Weight: 436.05
MDL number: MFCD00040394
EINECS: 206-404-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB151.20 | In Stock |
|
| 5g | RMB344.00 | In Stock |
|
| 25g | RMB1319.20 | In Stock |
|
| 100g | RMB3945.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 277-280°C (dec.) |
| RTECS | RH0783500 |
| form | Powder |
| color | off-white |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C8HF15O2.Na/c9-2(10,1(24)25)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)23;/h(H,24,25);/q;+1/p-1 |
| InChIKey | LWHQXUODFPPQTL-UHFFFAOYSA-M |
| SMILES | C(F)(F)(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C([O-])=O.[Na+] |
| CAS DataBase Reference | 335-95-5(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium perfluorooctanoate (335-95-5) |
Description and Uses
Sodium perfluorooctanoate on gel-to-liquid-crystalline phase transition of dipalmitoylphosphatidylcholine vesicle membrane.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29159000 |
