A0834712
Allyltriisopropylsilane , >95.0%(GC) , 24400-84-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 130 °C |
| Density | 0.824 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 169 °F |
| storage temp. | 2-8°C, stored under nitrogen |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.82 |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/C12H26Si/c1-8-9-13(10(2)3,11(4)5)12(6)7/h8,10-12H,1,9H2,2-7H3 |
| InChIKey | AKQHUJRZKBYZLC-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](CC=C)(C(C)C)C(C)C |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| TSCA | No |
| HS Code | 2931.90.9010 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
