A0837412
3-Aminobenzyl Alcohol , >98.0%(GC) , 1877-77-6
Synonym(s):
3-(Hydroxymethyl)aniline
CAS NO.:1877-77-6
Empirical Formula: C7H9NO
Molecular Weight: 123.15
MDL number: MFCD00007817
EINECS: 217-514-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB158.40 | In Stock |
|
| 100g | RMB432.80 | In Stock |
|
| 500g | RMB1800.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-95 °C (lit.) |
| Boiling point: | 229.26°C (rough estimate) |
| Density | 1.0877 (rough estimate) |
| refractive index | 1.5380 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 14.46±0.10(Predicted) |
| form | Fine Crystalline Powder |
| color | Beige or gray-beige to brown |
| Water Solubility | Soluble in water. |
| BRN | 2205844 |
| InChI | InChI=1S/C7H9NO/c8-7-3-1-2-6(4-7)5-9/h1-4,9H,5,8H2 |
| InChIKey | OJZQOQNSUZLSMV-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC=CC(N)=C1 |
| CAS DataBase Reference | 1877-77-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenemethanol, 3-amino-(1877-77-6) |
Description and Uses
3-Aminobenzyl alcohol, is used as a reagent in the synthesis of quinone analogs as dynamin GTPase inhibitors. Also used as a reagent in the synthesis of pyrrolo[2,1-f][1,2,4]triazines as novel hedgehog signaling pathway inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 26-37/39-36 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | DN3154450 |
| F | 8-10-23 |
| Hazard Note | Irritant/Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29221980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







