A3971812
Ethyl 4-nitrobenzoate , 99% , 99-77-4
Synonym(s):
Ethyl 4-nitrobenzoate
CAS NO.：99-77-4
Empirical Formula: C9H9NO4
Molecular Weight: 195.17
MDL number: MFCD00007351
EINECS: 202-786-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB49.60 | In Stock |
|
| 100G | RMB141.60 | In Stock |
|
| 500G | RMB598.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-59 °C (lit.) |
| Boiling point: | 182 °C |
| Density | 1.3544 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Crystalline Powder |
| color | Yellow |
| Merck | 14,3832 |
| BRN | 1912879 |
| InChI | InChI=1S/C9H9NO4/c1-2-14-9(11)7-3-5-8(6-4-7)10(12)13/h3-6H,2H2,1H3 |
| InChIKey | PHWSCBWNPZDYRI-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C1=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 99-77-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethyl 4-nitrobenzoate(99-77-4) |
| EPA Substance Registry System | Ethyl 4-nitrobenzoate (99-77-4) |
Description and Uses
Ethyl 4-Nitrobenzoate is used in preparation of p-dimethylaminobenzoate compounds.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H303 |
| Precautionary statements | P270-P301+P312-P403-P501c |
| Risk Statements | 33 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | DH5600000 |
| TSCA | Yes |
| HS Code | 29163990 |
