A0838112
2-Acetamido-6-hydroxypurine , >95.0%(HPLC)(T) , 19962-37-9
CAS NO.：19962-37-9
Empirical Formula: C7H7N5O2
Molecular Weight: 193.16
MDL number: MFCD00078201
EINECS: 243-443-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB82.80 | In Stock |
|
| 5G | RMB224.00 | In Stock |
|
| 25g | RMB880.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 260 °C |
| Boiling point: | 329.37°C (rough estimate) |
| Density | 1.4225 (rough estimate) |
| refractive index | 1.8000 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | DMSO (Slightly) |
| pka | 9.06±0.20(Predicted) |
| form | Powder |
| color | White to beige |
| Water Solubility | practically insoluble |
| InChI | InChI=1S/C7H7N5O2/c1-3(13)10-7-11-5-4(6(14)12-7)8-2-9-5/h2H,1H3,(H3,8,9,10,11,12,13,14) |
| InChIKey | MXSMRDDXWJSGMC-UHFFFAOYSA-N |
| SMILES | C(NC1NC(=O)C2=C(N=1)NC=N2)(=O)C |
| CAS DataBase Reference | 19962-37-9(CAS DataBase Reference) |
Description and Uses
Protected guanine
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| HS Code | 29335995 |
