A0843212
1-Adamantaneethanol , >98.0%(GC) , 6240-11-5
Synonym(s):
2-(1-Adamantyl)ethanol
CAS NO.:6240-11-5
Empirical Formula: C12H20O
Molecular Weight: 180.29
MDL number: MFCD00074756
EINECS: 228-353-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB117.60 | In Stock |
|
| 5G | RMB444.80 | In Stock |
|
| 25G | RMB1763.20 | In Stock |
|
| 100g | RMB5471.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-69 °C(lit.) |
| Boiling point: | 253.13°C (rough estimate) |
| Density | 0.9003 (rough estimate) |
| refractive index | 1.5050 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 15.32±0.10(Predicted) |
| color | White to Almost white |
| BRN | 1855382 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids, acid halides. |
| InChI | InChI=1S/C12H20O/c13-2-1-12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11,13H,1-8H2 |
| InChIKey | ZBIDZPHRNBZTLT-UHFFFAOYSA-N |
| SMILES | C12(CCO)CC3CC(CC(C3)C1)C2 |
| CAS DataBase Reference | 6240-11-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Adamantaneethanol(6240-11-5) |
Description and Uses
1-Adamantaneethanol was used in the synthesis of:
- 4-(adamant-1-ylethylenoxycarbonyl)phthalanhydride
- poly(2-methoxy-5-cyclohexylmethyloxy-p-phenylene vinylene)
- adamantine-containing phthalocyanines
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29061990 |





![(((4-(Bicyclo[3.3.1]Nonan-3-yl)-2-methylbutan-2-yl)oxy)carbonyl)-L-tryptophan](https://img.chemicalbook.com/CAS/GIF/68388-91-0.gif)
