A0849812
6-Amino-2-methylquinoline , >98.0% , 65079-19-8
CAS NO.：65079-19-8
Empirical Formula: C10H10N2
Molecular Weight: 158.2
MDL number: MFCD00052600
EINECS: 672-738-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB180.80 | In Stock |
|
| 1G | RMB599.20 | In Stock |
|
| 5G | RMB2559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-188 °C |
| Boiling point: | 273.29°C (rough estimate) |
| Density | 1.1192 (rough estimate) |
| refractive index | 1.6392 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 6.47±0.43(Predicted) |
| form | powder to crystal |
| color | Light yellow to Yellow to Green |
| Water Solubility | Soluble in water. |
| BRN | 114795 |
| InChI | InChI=1S/C10H10N2/c1-7-2-3-8-6-9(11)4-5-10(8)12-7/h2-6H,11H2,1H3 |
| InChIKey | TYJFYUVDUUACKX-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(N)=CC=2)C=CC=1C |
| CAS DataBase Reference | 65079-19-8(CAS DataBase Reference) |
| EPA Substance Registry System | 6-Quinolinamine, 2-methyl- (65079-19-8) |
Description and Uses
6-Amino-2-methylquinoline is used as an organic chemical synthesis intermediate.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H301-H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-22 |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29334900 |
