PRODUCT Properties
| Boiling point: | 105-107°C 15mm |
| Density | 1.02 |
| refractive index | 1.4700-1.4800 |
| Flash point: | 91° |
| storage temp. | Store at room temperature |
| Water Solubility | Soluble in water |
| form | clear liquid |
| pka | -0.41±0.20(Predicted) |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C6H11NO/c1-6(8)7-4-2-3-5-7/h2-5H2,1H3 |
| InChIKey | LNWWQYYLZVZXKS-UHFFFAOYSA-N |
| SMILES | C(=O)(N1CCCC1)C |
| CAS DataBase Reference | 4030-18-6(CAS DataBase Reference) |
Description and Uses
1-Acetylpyrrolidine is a useful reagent for the synthesis of disubstituted multifunctional indenes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P370+P378-P403+P235-P501 |
| Risk Statements | 10 |
| Safety Statements | 16 |
| RIDADR | 1993 |
| HS Code | 2933998090 |
