A0856012
2,2'-Azobis[2-(2-imidazolin-2-yl)propane] Dihydrochloride , >98.0%(HPLC) , 27776-21-2
CAS NO.:27776-21-2
Empirical Formula: C12H23ClN6
Molecular Weight: 286.81
MDL number: MFCD00142723
EINECS: 248-655-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB36.00 | In Stock |
|
| 100G | RMB112.80 | In Stock |
|
| 250G | RMB263.20 | In Stock |
|
| 500g | RMB411.20 | In Stock |
|
| 2.5kg | RMB1911.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190 °C(dec.) |
| Density | 1.303[at 20℃] |
| vapor pressure | 0.001Pa at 50℃ |
| Flash point: | 203℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| PH | pH(50g/l, 25℃) : 5.5~6.5 |
| Water Solubility | 200g/L at 20℃ |
| InChI | InChI=1S/C12H22N6.ClH/c1-11(2,9-13-5-6-14-9)17-18-12(3,4)10-15-7-8-16-10;/h5-8H2,1-4H3,(H,13,14)(H,15,16);1H/b18-17+; |
| InChIKey | WYFGBFHRZGNGAU-ZAGWXBKKSA-N |
| SMILES | C(C1NCCN=1)(C)(C)/N=N/C(C1NCCN=1)(C)C.Cl |
| LogP | -3.5 at 20℃ |
| EPA Substance Registry System | 1H-Imidazole, 2,2'-[azobis(1-methylethylidene)]bis[4,5-dihydro-, dihydrochloride (27776-21-2) |
Description and Uses
1,2-Bis(2-(4,5-dihydro-1H-imidazol-2-yl)propan-2-yl)diazene Dihydrochloride is used as an initiator in the synthesis of ultra heigh relative molecular mass polyarcrylamide.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H318-H335-H302+H312+H332-H315 |
| Precautionary statements | P280-P301+P312-P362+P364 |
| Risk Statements | 38 |
| Safety Statements | 45-36/37/39 |
| RIDADR | 3234 |
| RTECS | NI3506608 |
| TSCA | TSCA listed |
| HS Code | 29332900 |

![2,2'-Azobis[2-(2-imidazolin-2-yl)propane] Dihydrochloride](https://img.chemicalbook.com/CAS/GIF/27776-21-2.gif)




![2,2''-AZOBIS[2-(2-IMIDAZOLIN-2-YL)PROPANE]](https://img.chemicalbook.com/CAS/GIF/20858-12-2.gif)

