A0857212
4-Amino-2-methyl-5-pyrimidinemethanol , 95% , 73-67-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB135.20 | In Stock |
|
| 200MG | RMB207.20 | In Stock |
|
| 250mg | RMB245.60 | In Stock |
|
| 1G | RMB709.60 | In Stock |
|
| 5g | RMB2389.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193-198°; mp 198-200° |
| Boiling point: | 326.0±27.0 °C(Predicted) |
| Density | 1.285±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 13.31±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Merck | 14,9561 |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C6H9N3O/c1-4-8-2-5(3-10)6(7)9-4/h2,10H,3H2,1H3,(H2,7,8,9) |
| InChIKey | VUTBELPREDJDDH-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=C(CO)C(N)=N1 |
| CAS DataBase Reference | 73-67-6 |
Description and Uses
Toxopyrimidine is intermediate in thiamin biosynthetic pathway, a cofactor crucial for several enzymes involved in carbohydrate and amino acid metabolism.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| WGK Germany | WGK 3 |
| HS Code | 2933.59.9500 |
| Storage Class | 11 - Combustible Solids |






