A0857712
6-Acetoxy-7-methoxy-3<i>H</i>-quinazolin-4-one , >98.0%(HPLC)(T) , 179688-53-0
CAS NO.：179688-53-0
Empirical Formula: C11H10N2O4
Molecular Weight: 234.21
MDL number: MFCD09833010
EINECS: 808-050-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB50.72 | In Stock |
|
| 5G | RMB123.20 | In Stock |
|
| 25G | RMB367.20 | In Stock |
|
| 100g | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 293 °C |
| Boiling point: | 390.5±52.0 °C(Predicted) |
| Density | 1.39 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly) |
| form | powder to crystal |
| pka | 0.67±0.20(Predicted) |
| color | White to Yellow |
| InChI | InChI=1S/C11H10N2O4/c1-6(14)17-10-3-7-8(4-9(10)16-2)12-5-13-11(7)15/h3-5H,1-2H3,(H,12,13,15) |
| InChIKey | SOLQIFINSOHAQD-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(OC(C)=O)C(OC)=C2)C(=O)NC=1 |
| CAS DataBase Reference | 179688-53-0 |
Description and Uses
4-Hydroxy-7-methoxyquinazolin-6-yl Ester Acetic Acid exhibit potent inhibitory activity against VEGFR-2/HDAC and a human breast cancer cell line MCF-7.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| HS Code | 2933.79.1500 |
