A6008312
7-Methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4(3H)-one , 98% , 199327-61-2
CAS NO.:199327-61-2
Empirical Formula: C16H21N3O4
Molecular Weight: 319.36
MDL number: MFCD12760130
EINECS: 429-400-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB66.40 | In Stock |
|
| 25G | RMB193.60 | In Stock |
|
| 100G | RMB532.00 | In Stock |
|
| 500G | RMB2356.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 233-236 °C |
| Boiling point: | 519.5±60.0 °C(Predicted) |
| Density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 7.10±0.10(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C16H21N3O4/c1-21-14-10-13-12(16(20)18-11-17-13)9-15(14)23-6-2-3-19-4-7-22-8-5-19/h9-11H,2-8H2,1H3,(H,17,18,20) |
| InChIKey | WFUBWLXSYCFZEH-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(OCCCN3CCOCC3)C(OC)=C2)C(=O)NC=1 |
| CAS DataBase Reference | 199327-61-2(CAS DataBase Reference) |
Description and Uses
7-Methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4(3H)-one is a pharmaceutical intermediate used in the preparation of gefitinib, an orally active selective inhibitor of the epidermal growth factor receptor tyrosine kinase, an enzyme that regulates intracellular signalling pathways that associated with the proliferation and survival of cancer cells.
Gefitinib intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P260-P273-P280-P312 |
| WGK Germany | WGK 2 |
| HS Code | 2933599590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 |







