BD4803141
4-Methoxy-5-(3-morpholinopropoxy)-2-nitrobenzonitrile , 97% , 675126-26-8
CAS NO.:675126-26-8
Empirical Formula: C15H19N3O5
Molecular Weight: 321.33
MDL number: MFCD11110477
EINECS: 1806241-263-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5g | RMB109.60 | In Stock |
|
| 25g | RMB352.00 | In Stock |
|
| 100g | RMB1157.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 127℃ |
| Boiling point: | 522.3±50.0 °C(Predicted) |
| Density | 1.29 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 6.96±0.10(Predicted) |
| form | Solid |
| color | Light yellow to yellow |
| InChI | InChI=1S/C15H19N3O5/c1-21-14-10-13(18(19)20)12(11-16)9-15(14)23-6-2-3-17-4-7-22-8-5-17/h9-10H,2-8H2,1H3 |
| InChIKey | FYCDMKYKGPHRFW-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(OCCCN2CCOCC2)=C(OC)C=C1[N+]([O-])=O |
Description and Uses
4-Methoxy-5-[3-(morpholin-4-yl)propoxy]-2-nitrobenzonitrile is a useful research chemical compound used in the preparation of carbon-11 iressa as PET cancer imaging agent for epidermal growth factor receptor tyrosine kinase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2934999090 |







