A0863912
4-Acetylbenzoic Acid , >98.0% , 586-89-0
Synonym(s):
Acetophenone-4-carboxylic acid
CAS NO.:586-89-0
Empirical Formula: C9H8O3
Molecular Weight: 164.16
MDL number: MFCD00002561
EINECS: 209-588-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB318.40 | In Stock |
|
| 100G | RMB1056.00 | In Stock |
|
| 500g | RMB3671.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 208-210 °C(lit.) |
| Boiling point: | 251.61°C (rough estimate) |
| Density | 1.2132 (rough estimate) |
| refractive index | 1.5380 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | pK1: 3.70 (25°C) |
| form | Crystals or Crystalline Powder |
| color | White |
| Water Solubility | soluble |
| BRN | 2207355 |
| InChI | InChI=1S/C9H8O3/c1-6(10)7-2-4-8(5-3-7)9(11)12/h2-5H,1H3,(H,11,12) |
| InChIKey | QBHDSQZASIBAAI-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(C(C)=O)C=C1 |
| CAS DataBase Reference | 586-89-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Acetylbenzoic acid(586-89-0) |
Description and Uses
4-Acetylbenzoic acid was used in the preparation of an ester-derivative of paclitaxel.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P280g-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-37/38-36 |
| Safety Statements | 37/39-26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |




