A0870712
4-Acetamido-2-methylbenzoic Acid , >96.0%(HPLC)(T) , 103204-69-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB424.80 | In Stock |
|
| 25G | RMB1432.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 237-242 °C (lit.) |
| Boiling point: | 421.9±33.0 °C(Predicted) |
| Density | 1.276±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.04±0.25(Predicted) |
| color | White to Yellow |
| Major Application | peptide synthesis |
| InChI | 1S/C10H11NO3/c1-6-5-8(11-7(2)12)3-4-9(6)10(13)14/h3-5H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | AQPDTYYKDYMCTH-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(O)=O)c(C)c1 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2918999090 |
| Storage Class | 13 - Non Combustible Solids |
