A5041712
5-Iodoacetamidofluorescein(5-IAF) , ≥95%(HPLC) , 63368-54-7
Synonym(s):
5-IAF
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB1055.20 | In Stock |
|
| 100MG | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 265-267 °C (dec.)(lit.) |
| Boiling point: | 788.4±60.0 °C(Predicted) |
| Density | 1.95±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:3): 0.25 mg/ml; Ethanol: 500μg/ml |
| form | A crystalline solid |
| pka | 9.32±0.20(Predicted) |
| color | Light yellow to orange |
| Appearance | Solid Powder |
| BRN | 6543244 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C22H14INO6/c23-10-20(27)24-11-1-4-15-14(7-11)21(28)30-22(15)16-5-2-12(25)8-18(16)29-19-9-13(26)3-6-17(19)22/h1-9,25-26H,10H2,(H,24,27) |
| InChIKey | UATCLPJEZJKNHE-UHFFFAOYSA-N |
| SMILES | Oc1ccc2c(Oc3cc(O)ccc3C24OC(=O)c5cc(NC(=O)CI)ccc45)c1 |
Description and Uses
5-(Iodoacetamido)fluorescein is a thiol-reactive fluorescent probe used for preparation of green-fluorescent thiol conjugates of biomolecules.
5-(Iodoacetamido)fluorescein is a thiol reactive fluorescein derivative.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 8 |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
