A0875312
5-Amino-1,3-diphenylpyrazole , >97.0% , 5356-71-8
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB55.20 | In Stock |
|
| 250MG | RMB63.20 | In Stock |
|
| 1G | RMB189.60 | In Stock |
|
| 5G | RMB687.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-132 °C |
| Boiling point: | 454.0±33.0 °C(Predicted) |
| Density | 1.17±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.77±0.10(Predicted) |
| color | Light Beige |
| λmax | 258nm(EtOH)(lit.) |
| InChI | 1S/C15H13N3/c16-15-11-14(12-7-3-1-4-8-12)17-18(15)13-9-5-2-6-10-13/h1-11H,16H2 |
| InChIKey | SXOFMEWDEKEVJU-UHFFFAOYSA-N |
| SMILES | Nc1cc(nn1-c2ccccc2)-c3ccccc3 |
| CAS DataBase Reference | 5356-71-8(CAS DataBase Reference) |
Description and Uses
5-Amino-1,3-diphenyl-1H-pyrazole is a reagent for the preparation of molecular switches within GIRK activator scaffold that afford selective GIRK inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| RTECS | UQ5580000 |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
