A0881112
2-Amino-3,5-dichloropyridine , >98.0% , 4214-74-8
CAS NO.：4214-74-8
Empirical Formula: C5H4Cl2N2
Molecular Weight: 163
MDL number: MFCD00006313
EINECS: 224-143-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 100g | RMB296.00 | In Stock |
|
| 250g | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 81-83 °C(lit.) |
| Boiling point: | 268.76°C (rough estimate) |
| Density | 1.5462 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder or Crystals |
| pka | 2.43±0.10(Predicted) |
| color | Off-white to pink to beige |
| Water Solubility | insoluble |
| BRN | 119376 |
| InChI | InChI=1S/C5H4Cl2N2/c6-3-1-4(7)5(8)9-2-3/h1-2H,(H2,8,9) |
| InChIKey | OCWBGKZFOYMCCN-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(Cl)C=C1Cl |
| CAS DataBase Reference | 4214-74-8(CAS DataBase Reference) |
Description and Uses
3,5-Dichloropyridin-2-amine can be used as herbicidal active substances.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H302-H312-H332 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280h-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-37/39-28A-45-24/25 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
