A0883012
8-Amino-2-naphthalenesulfonic Acid , >97.0%(HPLC) , 119-28-8
Synonym(s):
1-Naphthylamine-7-sulfonic acid;Cleves acid-1,7
CAS NO.:119-28-8
Empirical Formula: C10H9NO3S
Molecular Weight: 223.25
MDL number: MFCD00044844
EINECS: 204-311-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB295.20 | In Stock |
|
| 100G | RMB791.20 | In Stock |
|
| 500G | RMB2775.20 | In Stock |
|
| 2.5kg | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C(lit.) |
| Boiling point: | 220°C (rough estimate) |
| Density | 1.3588 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Aqueous Base (Slightly), DMSO (Slightly, Sonicated) |
| form | Powder |
| pka | pK1: 3.66 (25°C) |
| Appearance | Gray to brown Solid |
| Merck | 14,2351 |
| BRN | 2115629 |
| InChI | InChI=1S/C10H9NO3S/c11-10-3-1-2-7-4-5-8(6-9(7)10)15(12,13)14/h1-6H,11H2,(H,12,13,14) |
| InChIKey | QEZZCWMQXHXAFG-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2N)=CC=C1S(O)(=O)=O |
| CAS DataBase Reference | 119-28-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Naphthylamine-7-sulfonic acid(119-28-8) |
| EPA Substance Registry System | 2-Naphthalenesulfonic acid, 8-amino- (119-28-8) |
Description and Uses
Intermediate of dyestuff
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2585 8/PG 3 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29214500 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Irrit. 2 |







