A0889512
2-Amino-4-methyl-5-nitropyridine , ≥98.0% , 21901-40-6
CAS NO.:21901-40-6
Empirical Formula: C6H7N3O2
Molecular Weight: 153.14
MDL number: MFCD00010692
EINECS: 624-887-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB54.40 | In Stock |
|
| 25G | RMB399.20 | In Stock |
|
| 100G | RMB1560.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223-225 °C (lit.) |
| Boiling point: | 276.04°C (rough estimate) |
| Density | 1.3682 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in DMSO. |
| pka | 3.44±0.24(Predicted) |
| form | Powder |
| color | Orange to yellow-brown |
| BRN | 137695 |
| InChI | InChI=1S/C6H7N3O2/c1-4-2-6(7)8-3-5(4)9(10)11/h2-3H,1H3,(H2,7,8) |
| InChIKey | GRBBNZYMXKTQAI-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C([N+]([O-])=O)C(C)=C1 |
| CAS DataBase Reference | 21901-40-6(CAS DataBase Reference) |
Description and Uses
2-Amino-4-methyl-5-nitropyridine was used in the preparation of matrix mixture required to study new technical developments for the direct tissue analysis of peptides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36/37/39-22-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





