A0893150
1-(2-Amino-4-methoxyphenyl)ethanone , 98% , 42465-53-2
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB159.20 | In Stock |
|
| 250mg | RMB466.40 | In Stock |
|
| 1g | RMB1166.40 | In Stock |
|
| 5g | RMB4084.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119-120 °C |
| Boiling point: | 327.3±22.0 °C(Predicted) |
| Density | 1.121±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 1.88±0.10(Predicted) |
| Appearance | White to light yellow Solid |
| InChI | InChI=1S/C9H11NO2/c1-6(11)8-4-3-7(12-2)5-9(8)10/h3-5H,10H2,1-2H3 |
| InChIKey | FOFUOGSRVUOROJ-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(OC)C=C1N)C |
| CAS DataBase Reference | 42465-53-2(CAS DataBase Reference) |
Description and Uses
1-(2-Amino-4-methoxyphenyl)ethanone is a useful research reagent for the synthesis of benzothiazine derivatives with antiproliferative activity.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H290 |
| Precautionary statements | P501-P260-P234-P264-P280-P390-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P406-P405 |
| HS Code | 2922500090 |
