A0893212
7-Acetoxy-4-methylcoumarin , >98.0% , 2747-05-9
Synonym(s):
MU-Ac
CAS NO.：2747-05-9
Empirical Formula: C12H10O4
Molecular Weight: 218.21
MDL number: MFCD00006865
EINECS: 220-386-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB173.60 | In Stock |
|
| 25g | RMB662.40 | In Stock |
|
| 100g | RMB2242.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 149-150 °C(lit.) |
| Boiling point: | 278.88°C (rough estimate) |
| Density | 1.1096 (rough estimate) |
| refractive index | 1.4270 (estimate) |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| BRN | 189667 |
| InChI | InChI=1S/C12H10O4/c1-7-5-12(14)16-11-6-9(15-8(2)13)3-4-10(7)11/h3-6H,1-2H3 |
| InChIKey | HXVZGASCDAGAPS-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(OC(C)=O)=CC=C2C(C)=C1 |
| CAS DataBase Reference | 2747-05-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 7-Acetoxy-4-methylcoumarin(2747-05-9) |
Description and Uses
Fluorogenic substrate for esterases, broadly applied to various types of esterases., including carboxyesterases. Measurement of intracellular pH in rat proximal convoluted tubule.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 2932209090 |
