PRODUCT Properties
| Melting point: | 121° |
| alpha | D20 -118.6°; D23 -122° (chloroform) |
| Boiling point: | 504.4±50.0 °C(Predicted) |
| Density | 1.385±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), DMSO (Slightly, Sonicated) |
| form | Solid |
| color | White to Off-White |
| Major Application | food and beverages |
| InChI | 1S/C20H18O6/c1-3-15-17(25-9-23-15)5-11(1)19-13-7-22-20(14(13)8-21-19)12-2-4-16-18(6-12)26-10-24-16/h1-6,13-14,19-20H,7-10H2 |
| InChIKey | PEYUIKBAABKQKQ-UHFFFAOYSA-N |
| SMILES | O1C(C4C(C(OC4)c5cc6c(cc5)OCO6)C1)c2cc3c(cc2)OCO3 |
Description and Uses
Asarinin is a lignan that has been found in A. sieboldii. It is an epimer of sesamin and a noncompetitive inhibitor of Δ5-desaturase (Ki = 0.28 mM). It is selective for Δ5-desaturase over Δ6- and Δ9-desaturase. Asarinin is cytotoxic to A2780 and SKOV3 ovarian cancer cells (IC50s = 38.45 and 60.87 μM, respectively) but not immortalized ovarian surface epithelial cells (IC50 = >200 μM). It induces apoptosis and activates caspase-3, -8, and -9 in A2780 and SKOV3 cells.
l-Asarinin in combination with pellitorine is a potential larvicides for the control of insecticide-resistant mosquito populations. Possesses antimicrobial activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
