A7566758
Mollugin , 10mMinDMSO , 55481-88-4
Synonym(s):
6-Hydroxy-2,2-dimethyl-2H-naphtho(1,2-b)pyran-5-carboxylic acid methyl ester;Rubimaillin
CAS NO.:55481-88-4
Empirical Formula: C17H16O4
Molecular Weight: 284.31
MDL number: MFCD02752331
EINECS: 683-209-5
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB301.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132~134℃ |
| Boiling point: | 453.2±45.0 °C(Predicted) |
| Density | 1.239±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| pka | 8.40±0.40(Predicted) |
| color | Yellow to Green |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | InChI=1S/C17H16O4/c1-17(2)9-8-12-13(16(19)20-3)14(18)10-6-4-5-7-11(10)15(12)21-17/h4-9,18H,1-3H3 |
| InChIKey | VLGATXOTCNBWIT-UHFFFAOYSA-N |
| SMILES | C12=C3C(C=CC=C3)=C(O)C(C(OC)=O)=C1C=CC(C)(C)O2 |
Description and Uses
Mollugin is an anti-tumor agent inducing apoptosis and autophagy in various cancer models.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






