A0899212
α,α'-Dihydroxy-1,4-diisopropylbenzene , >97.0% , 2948-46-1
Synonym(s):
α,α,α′,α′-Tetramethyl-1,4-benzenedimethanol
CAS NO.:2948-46-1
Empirical Formula: C12H18O2
Molecular Weight: 194.27
MDL number: MFCD00009827
EINECS: 220-964-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB93.60 | In Stock |
|
| 5G | RMB435.20 | In Stock |
|
| 25G | RMB1613.60 | In Stock |
|
| 100g | RMB5599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144-146 °C (lit.) |
| Boiling point: | 167-168 °C/12 mmHg (lit.) |
| Density | 1.0010 (rough estimate) |
| refractive index | 1.5050 (estimate) |
| Flash point: | 167-168°C/12mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 14.25±0.29(Predicted) |
| color | White to Light yellow |
| Water Solubility | Slightly Soluble in water (2.1 g/L) (25°C). |
| InChI | InChI=1S/C12H18O2/c1-11(2,13)9-5-7-10(8-6-9)12(3,4)14/h5-8,13-14H,1-4H3 |
| InChIKey | LEARFTRDZQQTDN-UHFFFAOYSA-N |
| SMILES | C(O)(C)(C)C1C=CC(C(O)(C)C)=CC=1 |
| CAS DataBase Reference | 2948-46-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Bis(2-hydroxy-2-propyl)benzene (2948-46-1) |
Description and Uses
1,4-Bis(2-hydroxyisopropyl)benzene is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2906290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 2948-46-1(Hazardous Substances Data) |






