A0924812
5-Amino-4-carbethoxy-1-phenylpyrazole , ≥98% , 16078-71-0
CAS NO.：16078-71-0
Empirical Formula: C12H13N3O2
Molecular Weight: 231.25
MDL number: MFCD00020731
EINECS: 240-224-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB51.20 | In Stock |
|
| 5G | RMB559.20 | In Stock |
|
| 25g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100 °C (lit.) |
| Boiling point: | 373.33°C (rough estimate) |
| Density | 1.1818 (rough estimate) |
| refractive index | 1.5290 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | methanol: soluble25mg/mL, clear, colorless |
| form | powder to crystal |
| pka | 0.55±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 211079 |
| InChI | InChI=1S/C12H13N3O2/c1-2-17-12(16)10-8-14-15(11(10)13)9-6-4-3-5-7-9/h3-8H,2,13H2,1H3 |
| InChIKey | AYJIUOZKKTUKKD-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC=C2)C(N)=C(C(OCC)=O)C=N1 |
| CAS DataBase Reference | 16078-71-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethyl 3-amino-2-phenylpyrazole-4-carboxylate(16078-71-0) |
| EPA Substance Registry System | 1H-Pyrazole-4-carboxylic acid, 5-amino-1-phenyl-, ethyl ester (16078-71-0) |
Description and Uses
Ethyl 5-amino-1-phenyl-4-pyrazolecarboxylate may be used as internal standard for the GC-MS determination of etomidate [ethyl-1-(1-phenylethyl)-1H-imidazole-5-carboxylate] in mouse brain tissue.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-37/39-36/37/39 |
| WGK Germany | 3 |
| RTECS | UQ6392025 |
| HS Code | 29331990 |
