A0925512
8-Aminooctanoic acid , 98% , 1002-57-9
Synonym(s):
ω-Aminocaprylic acid
CAS NO.：1002-57-9
Empirical Formula: C8H17NO2
Molecular Weight: 159.23
MDL number: MFCD00008245
EINECS: 213-687-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB287.20 | In Stock |
|
| 25G | RMB1167.20 | In Stock |
|
| 100G | RMB4207.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 194 °C (dec.) (lit.) |
| Boiling point: | 286.0±23.0 °C(Predicted) |
| Density | 1.0500 (estimate) |
| refractive index | 1.4630 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Methanol (Very Slightly), Water (Slightly) |
| pka | 4.76±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to slightly beige |
| Water Solubility | Soluble in water. |
| BRN | 1756493 |
| InChI | InChI=1S/C8H17NO2/c9-7-5-3-1-2-4-6-8(10)11/h1-7,9H2,(H,10,11) |
| InChIKey | UQXNEWQGGVUVQA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCCCN |
| CAS DataBase Reference | 1002-57-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 8-Aminocaprylic acid(1002-57-9) |
Description and Uses
8-Aminooctanoic acid is involved in the preparation of lactams using enzyme catalyzed aminolysis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| HS Code | 29224985 |
