S9546548
ERM?,certifiedreferencematerial , 9000-86-6
Synonym(s):
L -Alanine: 2-Oxoglutarate Aminotransferase;Alanine Aminotransferase (catalytic concentration);GPT
CAS NO.:9000-86-6
Empirical Formula: C11H16N2O6
Molecular Weight: 272.255
MDL number: MFCD00131192
EINECS: 232-561-4
| Pack Size | Price | Stock | Quantity |
| 1mL | RMB3570.82 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | -70°C |
| form | suspension (aqueous) |
| color | green-yellow |
| biological source | Porcine heart |
| Water Solubility | Dissolves readily at 5 mg/ml in 0.05M potassium phosphate pH 7.5 to give a clear, pale-green solution. Soluble in distilled water or dilute buffer. |
| BRN | 3562140 |
| Specific Activity | ≥75units/mg protein |
| InChI | InChI=1S/C11H16N2O6/c1-5-3-13(11(18)12-10(5)17)8-2-6(15)9(16)7(4-14)19-8/h3,6-9,14-16H,2,4H2,1H3,(H,12,17,18) |
| InChIKey | VVJYUAYZJAKGRQ-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C2CC(O)C(O)C(CO)O2)C=C(C)C(=O)N1 |
| EPA Substance Registry System | Aminotransferase, alanine (9000-86-6) |
Description and Uses
It is used for research and clinical diagnostic assays for liver disease. Alanine transaminase (GPT/ALT) is used in multi-analyte clinical chemistry controls and calibrators for major IVD manufacturers. The alanine aminotransferase (ALT) blood test is typically used to detect liver injury. Some of the other applications include Diagnostic Controls, calibrators & standards, immunoassays, clinical chemistry, testing/assay validation, life Science, manufacturing, validation Studies.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H334 |
| Precautionary statements | P261-P284-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Resp. Sens. 1 |







![Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)europium(III) [NMR Shift Reagent]](https://img.chemicalbook.com/CAS/GIF/15522-71-1.gif)