A0634512
Aluminum triacetylacetone , 98% , 13963-57-0
Synonym(s):
Al(acac)3;Aluminium acetylacetonate;Aluminum 2,4-pentanedionate;Tris(acetylacetonato)aluminium, Tris(2,4-pentanedionato)aluminium, Aluminium 2,4-pentanedionate
CAS NO.:13963-57-0
Empirical Formula: C15H21AlO6
Molecular Weight: 324.31
MDL number: MFCD00000013
EINECS: 237-741-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB43.20 | In Stock |
|
| 100G | RMB72.00 | In Stock |
|
| 500G | RMB223.20 | In Stock |
|
| 2.5kg | RMB792.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 190-193 °C(lit.) |
| Boiling point: | 315 °C(lit.) |
| Density | 1,27 g/cm3 |
| bulk density | 500kg/m3 |
| vapor pressure | 0Pa at 25℃ |
| Flash point: | 314-316°C |
| storage temp. | Store below +30°C. |
| solubility | 3g/l |
| form | Crystalline Powder |
| color | White to cream |
| Specific Gravity | 1.279 |
| PH | 8 (3g/l, H2O, 20℃) |
| Water Solubility | 2.5 g/L (20 ºC) |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 4157942 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions | BINDING |
| InChI | 1S/3C5H8O2.Al/c3*1-4(6)3-5(2)7;/h3*3,6H,1-2H3;/q;;;+3/p-3/b3*4-3-; |
| InChIKey | KILURZWTCGSYRE-LNTINUHCSA-K |
| SMILES | CC(=O)\C=C(\C)O[Al](O\C(C)=C/C(C)=O)O\C(C)=C/C(C)=O |
| LogP | -1.67 at 25℃ |
| CAS DataBase Reference | 13963-57-0 |
| NIST Chemistry Reference | Aluminum tris(acetylacetonate)(13963-57-0) |
| EPA Substance Registry System | Aluminum, tris(2,4-pentanedionato-.kappa.O,.kappa.O')-, (OC-6-11)- (13963-57-0) |
Description and Uses
Alumunium acetylacetonate may be used to prepare transparent superhydrophobic boehmite and silica films by sublimation, to deposit alumunium oxide films by chemical vapor deposition, to deposit alumunium oxide films by chemical vapor deposition, as a catalyst.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38-36-43 |
| Safety Statements | 26-36/37/39-45-28A-36/37 |
| RIDADR | UN 3467 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | BD2230000 |
| Autoignition Temperature | 500 °C |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29420000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 orally in Rabbit: 48.7 mg/kg |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |





