A4987812
Iron(III) acetylacetonate , 98% , 14024-18-1
Synonym(s):
Ferric acetylacetonate;Iron(III) acetylacetonate;Iron(III) 2,4-pentanedionate;Tris(acetylacetonato)iron(III), Tris(2,4-pentanedionato)iron(III);2,4-Pentanedione iron(III) derivative
CAS NO.：14024-18-1
Empirical Formula: C15H21FeO6
Molecular Weight: 353.17
MDL number: MFCD00000020
EINECS: 237-853-5
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB59.20 | In Stock |
|
| 500G | RMB208.80 | In Stock |
|
| 1KG | RMB414.40 | In Stock |
|
| 5kg | RMB1693.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-182 °C (dec.)(lit.) |
| Boiling point: | 110°C 2mm |
| bulk density | 500kg/m3 |
| Density | 5.24 g/mL at 25 °C(lit.) |
| vapor pressure | 2.6 hPa (110 °C) |
| storage temp. | Store below +30°C. |
| solubility | Soluble in toluene. |
| form | Powder |
| Specific Gravity | 5.24 |
| color | Red |
| Water Solubility | 2 g/L (20 ºC) |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 4157960 |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: TWA 1 mg/m3 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| InChI | 1S/3C5H8O2.Fe/c3*1-4(6)3-5(2)7;/h3*3,6H,1-2H3;/q;;;+3/p-3/b3*4-3-; |
| InChIKey | AQBLLJNPHDIAPN-LNTINUHCSA-K |
| SMILES | CC(=O)\C=C(\C)O[Fe](O\C(C)=C/C(C)=O)O\C(C)=C/C(C)=O |
| LogP | 0.4 at 20℃ |
| NIST Chemistry Reference | Iron tris(acetylacetonate)(14024-18-1) |
| EPA Substance Registry System | Iron, tris(2,4-pentanedionato-.kappa.O,.kappa.O')-, (OC-6-11)- (14024-18-1) |
Description and Uses
Iron(III) 2,4-pentanedionate is used as a precatalyst and reagent in organic chemistry. It acts as a precursor for highly crystalline (Zn, Fe)Fe2O4
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H318 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | NO8960000 |
| F | 21 |
| TSCA | TSCA listed |
| HS Code | 29420000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 |
| Toxicity | LD50 orally in Rabbit: 1872 mg/kg |
