A8354812
Vanadyl acetylacetonate , 98% , 3153-26-2
Synonym(s):
Bis(acetylacetonato)vanadium(IV) oxide, Bis(2,4-pentanedionato)vanadium(IV) oxide;Vanadium(IV) oxide acetylacetonate;Vanadium(IV)-oxy acetylacetonate;VO(acac)2
CAS NO.:3153-26-2
Empirical Formula: C10H14O5V
Molecular Weight: 265.16
MDL number: MFCD00000032
EINECS: 221-590-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB43.20 | In Stock |
|
| 10G | RMB44.00 | In Stock |
|
| 50G | RMB75.20 | In Stock |
|
| 100G | RMB150.40 | In Stock |
|
| 250G | RMB303.20 | In Stock |
|
| 500G | RMB558.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 235 °C (dec.)(lit.) |
| Boiling point: | 140°C 13mm |
| Density | 1,4 g/cm3 |
| bulk density | 450kg/m3 |
| vapor pressure | 0Pa at 20℃ |
| Flash point: | 79 °C |
| storage temp. | Store below +30°C. |
| solubility | Moderately soluble in acetone, ether and chloroform. Soluble in ethanol and benzene |
| form | Crystalline Powder |
| Specific Gravity | 1.4 |
| color | Green to blue-green |
| Water Solubility | practically insoluble |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 4138236 |
| Exposure limits | NIOSH: Ceiling 0.05 mg/m3 |
| Stability: | Stable, but air sensitive. May discolour upon exposure to air. Incompatible with strong oxidizing agents. |
| InChI | 1S/2C5H8O2.O.V/c2*1-4(6)3-5(2)7;;/h2*3,6H,1-2H3;;/q;;;+2/p-2/b2*4-3-;; |
| InChIKey | JFHJZWAQYMGNBE-SUKNRPLKSA-L |
| SMILES | CC(=O)\C=C(\C)O[V](=O)O\C(C)=C/C(C)=O |
| LogP | 0.4 at 20℃ |
| CAS DataBase Reference | 3153-26-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Bis(2,4-pentanedionato)oxovanadium(iv)(3153-26-2) |
| EPA Substance Registry System | Vanadium, oxobis(2,4-pentanedionato-.kappa.O,.kappa.O')-, (SP-5-21)- (3153-26-2) |
Description and Uses
Vanadyl acetylacetonate may be used as a precursor for the preparation of vanadium dioxide thin films for applications in “intelligent” window coating and data storage.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 22-26-36-36/37/39 |
| RIDADR | 3285 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29420000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





