A2332512
Copper acetylacetonate , 97% , 13395-16-9
Synonym(s):
Copper(II) acetylacetonate;Cupric acetylacetonate;Cu(acac)2;2,4-Pentanedione copper(II) derivative;Bis(2,4-pentanedionato)copper(II)
CAS NO.:13395-16-9
Empirical Formula: C10H14CuO4
Molecular Weight: 261.76
MDL number: MFCD00000016
EINECS: 236-477-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB34.40 | In Stock |
|
| 100G | RMB71.20 | In Stock |
|
| 250G | RMB157.60 | In Stock |
|
| 500G | RMB286.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 284-288 °C (dec.) (lit.) |
| Boiling point: | 160 °C (9.7513 mmHg) |
| bulk density | 200-400kg/m3 |
| Density | 0.721 g/cm3 |
| vapor pressure | 0.13 hPa (163 °C) |
| Flash point: | 160°C/10mm |
| storage temp. | Store below +30°C. |
| solubility | 0.2g/l |
| form | Crystalline Powder |
| color | Blue to blue-grayish |
| Specific Gravity | 1.594 |
| Water Solubility | 0.2 g/L (20 ºC) |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Sublimation | 160 ºC |
| BRN | 4157957 |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 1 mg/m3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/2C5H8O2.Cu/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-; |
| InChIKey | QYJPSWYYEKYVEJ-FDGPNNRMSA-L |
| SMILES | CC(=O)\C=C(\C)O[Cu]O\C(C)=C/C(C)=O |
| NIST Chemistry Reference | Copper, bis(2,4-pentanedionato-o,o')-(13395-16-9) |
| EPA Substance Registry System | Copper, bis(2,4-pentanedionato-.kappa.O,.kappa.O')-, (SP-4-1)- (13395-16-9) |
Description and Uses
Copper(II) acetylacetonate catalyzes coupling and carbene transfer reactions. Metal acetylacetonates are used as catalysts for polymerization of olefins and transesterification. They are used as PVC stabilizer. They are used as curing agents for epoxy resins, acrylic adhesives and silicone rubbers. They are used as solvents, lubricant additives, paint drier, and pesticides. They are used in glass coatings.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| RTECS | GL6520000 |
| TSCA | TSCA listed |
| HS Code | 29420000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 13395-16-9(Hazardous Substances Data) |
| Toxicity | LD50 ipr-mus: 19 mg/kg CHTHBK 16,371,71 |





