A0926550
Bis-(4-hydroxy-1-naphthyl)phenylmethanol , 95% , 6948-88-5
Synonym(s):
4,4′-(α-Hydroxybenzylidene)di-1-naphthol;p-naphtholbenzein
CAS NO.：6948-88-5
Empirical Formula: C27H20O3
Molecular Weight: 392.45
MDL number: MFCD00003979
EINECS: 230-116-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB213.60 | In Stock |
|
| 5g | RMB797.60 | In Stock |
|
| 25g | RMB3199.20 | In Stock |
|
| 50g | RMB5456.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230-235 °C(lit.) |
| Boiling point: | 477.16°C (rough estimate) |
| Density | 1.1098 (rough estimate) |
| refractive index | 1.5460 (estimate) |
| storage temp. | Amber Vial, Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 9.14±0.40(Predicted) |
| form | Powder |
| color | Red-brown |
| PH Range | 8.5(YELLOW)-9.8(GREEN) |
| InChI | InChI=1S/C27H20O3/c28-25-16-14-23(19-10-4-6-12-21(19)25)27(30,18-8-2-1-3-9-18)24-15-17-26(29)22-13-7-5-11-20(22)24/h1-17,28-30H |
| InChIKey | OUYLDJXFDLBCTQ-UHFFFAOYSA-N |
| SMILES | C(O)(C1C=CC=CC=1)(C1C=CC(O)=C2C=CC=CC=12)C1C=CC(O)=C2C=CC=CC=12 |
| CAS DataBase Reference | 6948-88-5(CAS DataBase Reference) |
Description and Uses
α-Naphtholbenzein can be used as an indicator during non-aqueous titration.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29071590 |
