A0933512
                    4-<WBR>ACETAMIDO-<WBR>3-<WBR>NITROANISOLE , 95% , 119-81-3
CAS NO.:119-81-3
Empirical Formula: C9H10N2O4
Molecular Weight: 210.19
MDL number: MFCD00017018
EINECS: 204-353-3
| Pack Size | Price | Stock | Quantity | 
| 1g | RMB87.20 | In Stock | 
                                                 | 
                                        
| 5G | RMB303.20 | In Stock | 
                                                 | 
                                        
| 25G | RMB1199.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 117-118°C | 
                                    
| Boiling point: | 349.7°C (rough estimate) | 
                                    
| Density | 1.3578 (rough estimate) | 
                                    
| refractive index | 1.5940 (estimate) | 
                                    
| storage temp. | Sealed in dry,Room Temperature | 
                                    
| solubility | Chloroform (Slightly), Methanol (Slightly) | 
                                    
| pka | 13.24±0.70(Predicted) | 
                                    
| form | Solid | 
                                    
| color | Yellow to Dark Yellow | 
                                    
| BRN | 2809678 | 
                                    
| InChI | InChI=1S/C9H10N2O4/c1-6(12)10-8-4-3-7(15-2)5-9(8)11(13)14/h3-5H,1-2H3,(H,10,12) | 
                                    
| InChIKey | QGEGALJODPBPGR-UHFFFAOYSA-N | 
                                    
| SMILES | C(NC1=CC=C(OC)C=C1[N+]([O-])=O)(=O)C | 
                                    
| CAS DataBase Reference | 119-81-3(CAS DataBase Reference) | 
                                    
| EPA Substance Registry System | 2'-Nitro-p-acetanisidide (119-81-3) | 
                                    
Description and Uses
Methacetin (M258770) derivative. Used in the synthesis of a Thiabendazole (T344150) metabolite.
Safety
| Symbol(GHS) | ![]() GHS06  | 
                                    
| Signal word | Warning | 
| Hazard statements | H301 | 
| Precautionary statements | P264-P270-P301+P310a-P321-P405-P501a | 
| Risk Statements | 22 | 
| Safety Statements | 22-36/37 | 
| RIDADR | 2811 | 
| RTECS | AE8310000 | 
| TSCA | Yes | 
| HazardClass | 6.1 | 
| PackingGroup | III | 
| HS Code | 2924190090 | 






