A0940312
2-<WBR>Amino-<WBR>5-<WBR>iodopyrimidine , 97% , 1445-39-2
CAS NO.：1445-39-2
Empirical Formula: C4H4IN3
Molecular Weight: 221
MDL number: MFCD01075666
EINECS: 625-750-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB80.00 | In Stock |
|
| 5G | RMB317.60 | In Stock |
|
| 25g | RMB1099.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 219 °C |
| Boiling point: | 364.9±34.0 °C(Predicted) |
| Density | 2.204±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 2.08±0.10(Predicted) |
| form | powder |
| Appearance | Off-white to light yellow Solid |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C4H4IN3/c5-3-1-7-4(6)8-2-3/h1-2H,(H2,6,7,8) |
| InChIKey | HAFKCGZQRIIADX-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(I)C=N1 |
| CAS DataBase Reference | 1445-39-2(CAS DataBase Reference) |
Description and Uses
2-Amino-5-iodopyrimidine is used as a reactant in the synthesis of aminopyrimidine and cyclic guanidine amino acids.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 37/39-26-39 |
| WGK Germany | 3 |
| HS Code | 2933599590 |
