A0961950
N-Acetyl-L-asparticacid , 98% , 997-55-7
CAS NO.:997-55-7
Empirical Formula: C6H9NO5
Molecular Weight: 175.14
MDL number: MFCD00020500
EINECS: 213-643-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB106.40 | In Stock |
|
| 25g | RMB451.20 | In Stock |
|
| 100g | RMB1615.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137-140 °C(lit.) |
| Boiling point: | 425.3±35.0 °C(Predicted) |
| alpha | 52 º (c=1, HAc) |
| Density | 1.422±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Aqueous Acid (Slightly, Sonicated), DMSO (Slightly, Heated) |
| pka | 3.14±0.10(Predicted) |
| form | Solid |
| color | White to Off-Whiite |
| optical activity | [α]20/D +12±1°, c = 2% in 6 M HCl |
| Merck | 13,845 |
| BRN | 1726198 |
| Major Application | peptide synthesis |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C6H9NO5/c1-3(8)7-4(6(11)12)2-5(9)10/h4H,2H2,1H3,(H,7,8)(H,9,10)(H,11,12)/t4-/m0/s1 |
| InChIKey | OTCCIMWXFLJLIA-BYPYZUCNSA-N |
| SMILES | CC(=O)N[C@@H](CC(O)=O)C(O)=O |
| CAS DataBase Reference | 997-55-7(CAS DataBase Reference) |
| EPA Substance Registry System | L-Aspartic acid, N-acetyl- (997-55-7) |
Description and Uses
N-Acetyl-L-aspartic acid is used in biological studies for metabolic alterations associated with schizophrenia.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 1 |
| RTECS | CI9098600 |
| HS Code | 2924190090 |
| Storage Class | 11 - Combustible Solids |





