A0965112
1-Adamantyl isothiocyanate , 98% , 4411-26-1
CAS NO.:4411-26-1
Empirical Formula: C11H15NS
Molecular Weight: 193.31
MDL number: MFCD00074736
EINECS: 224-564-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB248.80 | In Stock |
|
| 5G | RMB756.80 | In Stock |
|
| 25g | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 166-168 °C (lit.) |
| Density | 1.35 |
| refractive index | 1.5500 (estimate) |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C11H15NS/c13-7-12-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-6H2 |
| InChIKey | YPKFLUARLJRPQM-UHFFFAOYSA-N |
| SMILES | C12(N=C=S)CC3CC(CC(C3)C1)C2 |
| CAS DataBase Reference | 4411-26-1(CAS DataBase Reference) |
Description and Uses
1-Adamantyl isothiocyanate was used in the synthesis of:
- tris(2-mercapto-1-adamantylimidazolyl)hydroborato ligand
- 1-adamantyl-3-(2-(7-methoxy-1,2,3,4-tetrahydroacridin-9-ylamino)alkane)thiourea 2,3-dihydroxysuccinates
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HS Code | 2930.90.9250 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






