A0983950
Dimethylphosphonate , 98% , 868-85-9
CAS NO.：868-85-9
Empirical Formula: C2H7O3P
Molecular Weight: 110.05
MDL number: MFCD00044633
EINECS: 212-783-8
| Pack Size | Price | Stock | Quantity |
| 100ml | RMB43.20 | In Stock |
|
| 500ml | RMB126.40 | In Stock |
|
| 2.5L | RMB447.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 170-171 °C(lit.) |
| Density | 1.2 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 71 °C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Colorless liquid with a mild
odor |
| Water Solubility | Soluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 1697490 |
| Stability: | Stable. Moisture sensitive. Incompatible with water, strong oxidizing agents, acid chlorides, strong bases. |
| InChI | InChI=1S/C2H7O3P/c1-4-6(3)5-2/h6H,1-2H3 |
| InChIKey | HZCDANOFLILNSA-UHFFFAOYSA-N |
| SMILES | P(=O)(OC)OC |
| CAS DataBase Reference | 868-85-9(CAS DataBase Reference) |
| IARC | 3 (Vol. 48, 71) 1999 |
| NIST Chemistry Reference | Phosphonic acid, dimethyl ester(868-85-9) |
| EPA Substance Registry System | Dimethyl phosphite (868-85-9) |
Description and Uses
As a flame retardant on Nylon 6 fibers; intermediate in the production of pesticides and herbicides; as a stabilizer in oil and plaster; an additive to lubricants
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H317-H341-H351-H412 |
| Precautionary statements | P201-P273-P280-P302+P352-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 21-36-10-68-52/53-43-40 |
| Safety Statements | 26-36/37-61 |
| RIDADR | UN 3278 6.1/PG 3 |
| WGK Germany | 1 |
| RTECS | SZ7710000 |
| TSCA | Yes |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29209013 |
| Hazardous Substances Data | 868-85-9(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
