A3388512
Dibenzyl Phosphite , ≥95.0% , 17176-77-1
Synonym(s):
Dibenzyl phosphonate
CAS NO.:17176-77-1
Empirical Formula: C14H15O3P
Molecular Weight: 262.24
MDL number: MFCD00004774
EINECS: 241-226-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB113.60 | In Stock |
|
| 25G | RMB445.60 | In Stock |
|
| 100G | RMB1472.80 | In Stock |
|
| 250g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 0 to 5° |
| Boiling point: | 110-120 °C/0.01 mmHg (lit.) |
| Density | 1.187 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to yellow |
| Water Solubility | Soluble in DMSO, Methanol. Reacts with water. |
| Sensitive | Air & Moisture Sensitive |
| Merck | 14,3014 |
| BRN | 1982794 |
| InChI | 1S/C14H15O3P/c15-18(16-11-13-7-3-1-4-8-13)17-12-14-9-5-2-6-10-14/h1-10,18H,11-12H2 |
| InChIKey | DYUGVWSETOTNKQ-UHFFFAOYSA-N |
| SMILES | O=[PH](OCc1ccccc1)OCc2ccccc2 |
| CAS DataBase Reference | 17176-77-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Dibenzyl phosphite(17176-77-1) |
Description and Uses
In preparation of N-phosphorylated amines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36 |
| RIDADR | UN3278 |
| WGK Germany | 3 |
| F | 21 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29209090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






