A3118312
Diisopropyl phosphite , 98% , 1809-20-7
CAS NO.：1809-20-7
Empirical Formula: C6H15O3P
Molecular Weight: 166.16
MDL number: MFCD00117905
EINECS: 217-317-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.80 | In Stock |
|
| 10g | RMB34.40 | In Stock |
|
| 25G | RMB66.40 | In Stock |
|
| 100G | RMB178.40 | In Stock |
|
| 500G | RMB657.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 71 °C (8 mmHg) |
| Density | 0.997 |
| refractive index | 1.4065-1.4085 |
| Flash point: | 69°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Sparingly) |
| form | Liquid |
| Specific Gravity | 1 |
| color | Clear colorless |
| Water Solubility | soluble |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C6H15O3P/c1-5(2)8-10(7)9-6(3)4/h5-6,10H,1-4H3 |
| InChIKey | BLKXLEPPVDUHBY-UHFFFAOYSA-N |
| SMILES | P(=O)(OC(C)C)OC(C)C |
| CAS DataBase Reference | 1809-20-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Phosphonic acid, di-isopropyl ester(1809-20-7) |
| EPA Substance Registry System | Phosphonic acid, bis(1-methylethyl) ester (1809-20-7) |
Description and Uses
Diisopropyl phosphite is used as antiwear lubricant additive together with triphenyl thiophosphate on T8 steel/Al2O3 ceramics.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26 |
| RIDADR | 3265 |
| RTECS | SZ7660000 |
| TSCA | Yes |
| HS Code | 29209085 |
| Toxicity | guinea pig,LC50,inhalation,9010mg/m3 (9010mg/m3),LUNGS, THORAX, OR RESPIRATION: OTHER CHANGESGASTROINTESTINAL: CHANGES IN STRUCTURE OR FUNCTION OF SALIVARY GLANDSBEHAVIORAL: CONVULSIONS OR EFFECT ON SEIZURE THRESHOLD,Gigiena Truda i Professional'nye Zabolevaniya. Labor Hygiene and Occupational Diseases. Vol. 29(11), Pg. 51, 1985. |
