A0997450
(2-Amino-3,5-dibromophenyl)methanol , ≥95% , 50739-76-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB72.80 | In Stock |
|
| 1g | RMB182.40 | In Stock |
|
| 5g | RMB662.40 | In Stock |
|
| 25g | RMB2608.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-148°C |
| Boiling point: | 366.3±37.0 °C(Predicted) |
| Density | 2.037±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.83±0.10(Predicted) |
| color | Off-White to Pale Yellow |
| InChI | InChI=1S/C7H7Br2NO/c8-5-1-4(3-11)7(10)6(9)2-5/h1-2,11H,3,10H2 |
| InChIKey | GHUMSGGCKVMYGH-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC(Br)=CC(Br)=C1N |
Description and Uses
Byproduct of Ambroxol synthesis. An impurity arising in the synthesis of Bromhexine (B678600).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P280-P301+P312-P304+P340 |
| HS Code | 2921490090 |
